C8H21N2O5PS2 — CID 59745211
3-[2-[3-(phosphanylamino)propylsulfonyl]ethylamino]propane-1-sulfonic acid (PubChem CID 59745211) has the molecular formula C8H21N2O5PS2 and a molecular weight of 320.37 g/mol. Its IUPAC name is 3-[2-[3-(phosphanylamino)propylsulfonyl]ethylamino]propane-1-sulfonic acid.
| Compound Name | 3-[2-[3-(phosphanylamino)propylsulfonyl]ethylamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59745211 |
| Molecular Formula | C8H21N2O5PS2 |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 3-[2-[3-(phosphanylamino)propylsulfonyl]ethylamino]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCNCCS(=O)(=O)CCCNP |
| InChI | InChI=1S/C8H21N2O5PS2/c11-17(12,6-2-4-10-16)8-5-9-3-1-7-18(13,14)15/h9-10H,1-8,16H2,(H,13,14,15) |
| InChIKey | TZLXZZWSXYFLRR-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|