C13H31N3O9S3 — CID 172808172
3-[2-[2-[3-(3-sulfopropoxysulfonyl)propylamino]ethylamino]ethylamino]propane-1-sulfonic acid (PubChem CID 172808172) has the molecular formula C13H31N3O9S3 and a molecular weight of 469.60 g/mol. Its IUPAC name is 3-[2-[2-[3-(3-sulfopropoxysulfonyl)propylamino]ethylamino]ethylamino]propane-1-sulfonic acid.
| Compound Name | 3-[2-[2-[3-(3-sulfopropoxysulfonyl)propylamino]ethylamino]ethylamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 172808172 |
| Molecular Formula | C13H31N3O9S3 |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 3-[2-[2-[3-(3-sulfopropoxysulfonyl)propylamino]ethylamino]ethylamino]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCNCCNCCNCCCS(=O)(=O)OCCCS(=O)(=O)O |
| InChI | InChI=1S/C13H31N3O9S3/c17-26(18,19)11-1-4-14-6-8-16-9-7-15-5-2-13-28(23,24)25-10-3-12-27(20,21)22/h14-16H,1-13H2,(H,17,18,19)(H,20,21,22) |
| InChIKey | RUMBFRIZHPXNRV-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 188.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|