C9H20F3N3O3S — CID 172503314
2,2,2-trifluoroethyl 3-[2-(2-aminoethylamino)ethylamino]propane-1-sulfonate (PubChem CID 172503314) has the molecular formula C9H20F3N3O3S and a molecular weight of 307.34 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 3-[2-(2-aminoethylamino)ethylamino]propane-1-sulfonate.
| Compound Name | 2,2,2-trifluoroethyl 3-[2-(2-aminoethylamino)ethylamino]propane-1-sulfonate |
|---|---|
| PubChem CID | 172503314 |
| Molecular Formula | C9H20F3N3O3S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2,2,2-trifluoroethyl 3-[2-(2-aminoethylamino)ethylamino]propane-1-sulfonate |
| SMILES | NCCNCCNCCCS(=O)(=O)OCC(F)(F)F |
| InChI | InChI=1S/C9H20F3N3O3S/c10-9(11,12)8-18-19(16,17)7-1-3-14-5-6-15-4-2-13/h14-15H,1-8,13H2 |
| InChIKey | MZWMXZSBZXELKT-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|