C7H15F3N2O2S — CID 114385128
2-(5,5,5-trifluoropentylamino)ethanesulfonamide (PubChem CID 114385128) has the molecular formula C7H15F3N2O2S and a molecular weight of 248.27 g/mol. Its IUPAC name is 2-(5,5,5-trifluoropentylamino)ethanesulfonamide.
| Compound Name | 2-(5,5,5-trifluoropentylamino)ethanesulfonamide |
|---|---|
| PubChem CID | 114385128 |
| Molecular Formula | C7H15F3N2O2S |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 2-(5,5,5-trifluoropentylamino)ethanesulfonamide |
| SMILES | NS(=O)(=O)CCNCCCCC(F)(F)F |
| InChI | InChI=1S/C7H15F3N2O2S/c8-7(9,10)3-1-2-4-12-5-6-15(11,13)14/h12H,1-6H2,(H2,11,13,14) |
| InChIKey | NDDMXDLXIJGQLE-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|