C8H17F3N2O2S — CID 106336415
N-[3-(4,4,4-trifluorobutylamino)propyl]methanesulfonamide (PubChem CID 106336415) has the molecular formula C8H17F3N2O2S and a molecular weight of 262.30 g/mol. Its IUPAC name is N-[3-(4,4,4-trifluorobutylamino)propyl]methanesulfonamide.
| Compound Name | N-[3-(4,4,4-trifluorobutylamino)propyl]methanesulfonamide |
|---|---|
| PubChem CID | 106336415 |
| Molecular Formula | C8H17F3N2O2S |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | N-[3-(4,4,4-trifluorobutylamino)propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCNCCCC(F)(F)F |
| InChI | InChI=1S/C8H17F3N2O2S/c1-16(14,15)13-7-3-6-12-5-2-4-8(9,10)11/h12-13H,2-7H2,1H3 |
| InChIKey | OUVBUCMKZLBEQD-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|