C6H11F3N2O3S — CID 103637532
2,2,2-trifluoro-N-[3-(methanesulfonamido)propyl]acetamide (PubChem CID 103637532) has the molecular formula C6H11F3N2O3S and a molecular weight of 248.23 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-(methanesulfonamido)propyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[3-(methanesulfonamido)propyl]acetamide |
|---|---|
| PubChem CID | 103637532 |
| Molecular Formula | C6H11F3N2O3S |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-(methanesulfonamido)propyl]acetamide |
| SMILES | CS(=O)(=O)NCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C6H11F3N2O3S/c1-15(13,14)11-4-2-3-10-5(12)6(7,8)9/h11H,2-4H2,1H3,(H,10,12) |
| InChIKey | ROQPDZWIQIYWBU-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|