C5H8F3NO3S2 — CID 23401497
2,2,2-trifluoro-N-(2-methylsulfonylsulfanylethyl)acetamide (PubChem CID 23401497) has the molecular formula C5H8F3NO3S2 and a molecular weight of 251.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(2-methylsulfonylsulfanylethyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(2-methylsulfonylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 23401497 |
| Molecular Formula | C5H8F3NO3S2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 250.99 |
| IUPAC Name | 2,2,2-trifluoro-N-(2-methylsulfonylsulfanylethyl)acetamide |
| SMILES | CS(=O)(=O)SCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C5H8F3NO3S2/c1-14(11,12)13-3-2-9-4(10)5(6,7)8/h2-3H2,1H3,(H,9,10) |
| InChIKey | YYNYHLFOZQCSQC-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|