C8H15F3N2O3S — CID 62727869
N-[3-[ethyl(methylsulfonyl)amino]propyl]-2,2,2-trifluoroacetamide (PubChem CID 62727869) has the molecular formula C8H15F3N2O3S and a molecular weight of 276.28 g/mol. Its IUPAC name is N-[3-[ethyl(methylsulfonyl)amino]propyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[ethyl(methylsulfonyl)amino]propyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 62727869 |
| Molecular Formula | C8H15F3N2O3S |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | N-[3-[ethyl(methylsulfonyl)amino]propyl]-2,2,2-trifluoroacetamide |
| SMILES | CCN(CCCNC(=O)C(F)(F)F)S(C)(=O)=O |
| InChI | InChI=1S/C8H15F3N2O3S/c1-3-13(17(2,15)16)6-4-5-12-7(14)8(9,10)11/h3-6H2,1-2H3,(H,12,14) |
| InChIKey | BBXUSXGINOPJMF-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|