C14H32N4O4S — CID 111405113
1-[3-[ethyl(methylsulfonyl)amino]propyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine (PubChem CID 111405113) has the molecular formula C14H32N4O4S and a molecular weight of 352.50 g/mol. Its IUPAC name is 1-[3-[ethyl(methylsulfonyl)amino]propyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine.
| Compound Name | 1-[3-[ethyl(methylsulfonyl)amino]propyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111405113 |
| Molecular Formula | C14H32N4O4S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | 1-[3-[ethyl(methylsulfonyl)amino]propyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine |
| SMILES | CCN(CCCN/C(=N/C)NCCCOCCOC)S(C)(=O)=O |
| InChI | InChI=1S/C14H32N4O4S/c1-5-18(23(4,19)20)10-6-8-16-14(15-2)17-9-7-11-22-13-12-21-3/h5-13H2,1-4H3,(H2,15,16,17) |
| InChIKey | OPZUNFGQZSHDSQ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|