C13H29N3O4 — CID 111405155
1-[2-(2-methoxyethoxy)ethyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine (PubChem CID 111405155) has the molecular formula C13H29N3O4 and a molecular weight of 291.39 g/mol. Its IUPAC name is 1-[2-(2-methoxyethoxy)ethyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine.
| Compound Name | 1-[2-(2-methoxyethoxy)ethyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111405155 |
| Molecular Formula | C13H29N3O4 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 1-[2-(2-methoxyethoxy)ethyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCCOCCOC)NCCOCCOC |
| InChI | InChI=1S/C13H29N3O4/c1-14-13(16-6-8-20-12-10-18-3)15-5-4-7-19-11-9-17-2/h4-12H2,1-3H3,(H2,14,15,16) |
| InChIKey | ZBFHHRYAUVTXKN-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|