C13H30IN3O3 — CID 111491655
1-[2-(2-butoxyethoxy)ethyl]-3-(2-methoxyethyl)-2-methylguanidine;hydroiodide (PubChem CID 111491655) has the molecular formula C13H30IN3O3 and a molecular weight of 403.31 g/mol. Its IUPAC name is 1-[2-(2-butoxyethoxy)ethyl]-3-(2-methoxyethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(2-butoxyethoxy)ethyl]-3-(2-methoxyethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111491655 |
| Molecular Formula | C13H30IN3O3 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 1-[2-(2-butoxyethoxy)ethyl]-3-(2-methoxyethyl)-2-methylguanidine;hydroiodide |
| SMILES | CCCCOCCOCCN/C(=N/C)NCCOC.I |
| InChI | InChI=1S/C13H29N3O3.HI/c1-4-5-8-18-11-12-19-10-7-16-13(14-2)15-6-9-17-3;/h4-12H2,1-3H3,(H2,14,15,16);1H |
| InChIKey | LUJJDHLUPBMJPB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|