C12H28IN3O2 — CID 111150615
1-butyl-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111150615) has the molecular formula C12H28IN3O2 and a molecular weight of 373.28 g/mol. Its IUPAC name is 1-butyl-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-butyl-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111150615 |
| Molecular Formula | C12H28IN3O2 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 1-butyl-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine;hydroiodide |
| SMILES | CCCCN/C(=N\C)NCCCOCCOC.I |
| InChI | InChI=1S/C12H27N3O2.HI/c1-4-5-7-14-12(13-2)15-8-6-9-17-11-10-16-3;/h4-11H2,1-3H3,(H2,13,14,15);1H |
| InChIKey | XMTOLNSFAJCUOP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|