C11H25N3O3 — CID 110942314
1-[3-(2-methoxyethoxy)propyl]-3-(2-methoxyethyl)-2-methylguanidine (PubChem CID 110942314) has the molecular formula C11H25N3O3 and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-[3-(2-methoxyethoxy)propyl]-3-(2-methoxyethyl)-2-methylguanidine.
| Compound Name | 1-[3-(2-methoxyethoxy)propyl]-3-(2-methoxyethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 110942314 |
| Molecular Formula | C11H25N3O3 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 1-[3-(2-methoxyethoxy)propyl]-3-(2-methoxyethyl)-2-methylguanidine |
| SMILES | C/N=C(/NCCCOCCOC)NCCOC |
| InChI | InChI=1S/C11H25N3O3/c1-12-11(14-6-8-15-2)13-5-4-7-17-10-9-16-3/h4-10H2,1-3H3,(H2,12,13,14) |
| InChIKey | GYVBJACGZOTWMK-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|