C13H30IN3O5S — CID 111519250
1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide (PubChem CID 111519250) has the molecular formula C13H30IN3O5S and a molecular weight of 467.37 g/mol. Its IUPAC name is 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111519250 |
| Molecular Formula | C13H30IN3O5S |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 1-[3-(2-methoxyethoxy)propyl]-2-methyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCCOC)NCCOCCS(C)(=O)=O.I |
| InChI | InChI=1S/C13H29N3O5S.HI/c1-14-13(15-5-4-7-20-10-9-19-2)16-6-8-21-11-12-22(3,17)18;/h4-12H2,1-3H3,(H2,14,15,16);1H |
| InChIKey | DXXVFNLLEQDHGY-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|