C12H29IN4O4S — CID 111406998
1-[3-(methanesulfonamido)propyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111406998) has the molecular formula C12H29IN4O4S and a molecular weight of 452.36 g/mol. Its IUPAC name is 1-[3-(methanesulfonamido)propyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(methanesulfonamido)propyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111406998 |
| Molecular Formula | C12H29IN4O4S |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 1-[3-(methanesulfonamido)propyl]-3-[3-(2-methoxyethoxy)propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCCNS(C)(=O)=O)NCCCOCCOC.I |
| InChI | InChI=1S/C12H28N4O4S.HI/c1-13-12(14-6-4-8-16-21(3,17)18)15-7-5-9-20-11-10-19-2;/h16H,4-11H2,1-3H3,(H2,13,14,15);1H |
| InChIKey | WWPHBJHINBCRES-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|