C12H28N4O3S — CID 111946189
1-(4-ethoxybutyl)-3-[3-(methanesulfonamido)propyl]-2-methylguanidine (PubChem CID 111946189) has the molecular formula C12H28N4O3S and a molecular weight of 308.45 g/mol. Its IUPAC name is 1-(4-ethoxybutyl)-3-[3-(methanesulfonamido)propyl]-2-methylguanidine.
| Compound Name | 1-(4-ethoxybutyl)-3-[3-(methanesulfonamido)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111946189 |
| Molecular Formula | C12H28N4O3S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 1-(4-ethoxybutyl)-3-[3-(methanesulfonamido)propyl]-2-methylguanidine |
| SMILES | CCOCCCCN/C(=N\C)NCCCNS(C)(=O)=O |
| InChI | InChI=1S/C12H28N4O3S/c1-4-19-11-6-5-8-14-12(13-2)15-9-7-10-16-20(3,17)18/h16H,4-11H2,1-3H3,(H2,13,14,15) |
| InChIKey | ZJECZIVINIAWEV-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|