C9H22IN3O3S — CID 110974576
1-(3-methoxypropyl)-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide (PubChem CID 110974576) has the molecular formula C9H22IN3O3S and a molecular weight of 379.26 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 1-(3-methoxypropyl)-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110974576 |
| Molecular Formula | C9H22IN3O3S |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 1-(3-methoxypropyl)-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOC)NCCS(C)(=O)=O.I |
| InChI | InChI=1S/C9H21N3O3S.HI/c1-10-9(11-5-4-7-15-2)12-6-8-16(3,13)14;/h4-8H2,1-3H3,(H2,10,11,12);1H |
| InChIKey | VDITVDCZTXYTGX-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|