C10H24IN3O3S — CID 111605164
1-(2-methoxy-2-methylpropyl)-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide (PubChem CID 111605164) has the molecular formula C10H24IN3O3S and a molecular weight of 393.29 g/mol. Its IUPAC name is 1-(2-methoxy-2-methylpropyl)-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 1-(2-methoxy-2-methylpropyl)-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111605164 |
| Molecular Formula | C10H24IN3O3S |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 1-(2-methoxy-2-methylpropyl)-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCS(C)(=O)=O)NCC(C)(C)OC.I |
| InChI | InChI=1S/C10H23N3O3S.HI/c1-10(2,16-4)8-13-9(11-3)12-6-7-17(5,14)15;/h6-8H2,1-5H3,(H2,11,12,13);1H |
| InChIKey | ZKBYUNISIRQGIC-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|