C10H23N3O2S2 — CID 111609288
2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-(2-methylsulfonylethyl)guanidine (PubChem CID 111609288) has the molecular formula C10H23N3O2S2 and a molecular weight of 281.45 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-(2-methylsulfonylethyl)guanidine.
| Compound Name | 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-(2-methylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 111609288 |
| Molecular Formula | C10H23N3O2S2 |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-methyl-1-(2-methyl-2-methylsulfanylpropyl)-3-(2-methylsulfonylethyl)guanidine |
| SMILES | C/N=C(\NCCS(C)(=O)=O)NCC(C)(C)SC |
| InChI | InChI=1S/C10H23N3O2S2/c1-10(2,16-4)8-13-9(11-3)12-6-7-17(5,14)15/h6-8H2,1-5H3,(H2,11,12,13) |
| InChIKey | HKUHIQWGMNPAGP-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|