C17H29IN4O2S2 — CID 111609431
1-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide (PubChem CID 111609431) has the molecular formula C17H29IN4O2S2 and a molecular weight of 512.48 g/mol. Its IUPAC name is 1-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111609431 |
| Molecular Formula | C17H29IN4O2S2 |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | 1-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCS(=O)(=O)N1CCc2ccccc21)NCC(C)(C)SC.I |
| InChI | InChI=1S/C17H28N4O2S2.HI/c1-17(2,24-4)13-20-16(18-3)19-10-12-25(22,23)21-11-9-14-7-5-6-8-15(14)21;/h5-8H,9-13H2,1-4H3,(H2,18,19,20);1H |
| InChIKey | OVAQYQCBKPKFBH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|