C22H36N4O3S — CID 111622906
1-[(2-tert-butyloxan-3-yl)methyl]-3-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-2-methylguanidine (PubChem CID 111622906) has the molecular formula C22H36N4O3S and a molecular weight of 436.62 g/mol. Its IUPAC name is 1-[(2-tert-butyloxan-3-yl)methyl]-3-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[(2-tert-butyloxan-3-yl)methyl]-3-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111622906 |
| Molecular Formula | C22H36N4O3S |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 1-[(2-tert-butyloxan-3-yl)methyl]-3-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCS(=O)(=O)N1CCc2ccccc21)NCC1CCCOC1C(C)(C)C |
| InChI | InChI=1S/C22H36N4O3S/c1-22(2,3)20-18(9-7-14-29-20)16-25-21(23-4)24-12-15-30(27,28)26-13-11-17-8-5-6-10-19(17)26/h5-6,8,10,18,20H,7,9,11-16H2,1-4H3,(H2,23,24,25) |
| InChIKey | BGGCVQNELVQLSN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|