C8H19N3O2S2 — CID 111343719
2-methyl-1-(2-methylsulfanylethyl)-3-(2-methylsulfonylethyl)guanidine (PubChem CID 111343719) has the molecular formula C8H19N3O2S2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-methyl-1-(2-methylsulfanylethyl)-3-(2-methylsulfonylethyl)guanidine.
| Compound Name | 2-methyl-1-(2-methylsulfanylethyl)-3-(2-methylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 111343719 |
| Molecular Formula | C8H19N3O2S2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-methyl-1-(2-methylsulfanylethyl)-3-(2-methylsulfonylethyl)guanidine |
| SMILES | C/N=C(\NCCSC)NCCS(C)(=O)=O |
| InChI | InChI=1S/C8H19N3O2S2/c1-9-8(10-4-6-14-2)11-5-7-15(3,12)13/h4-7H2,1-3H3,(H2,9,10,11) |
| InChIKey | MXPVZPFZZZHFLR-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|