C9H22IN3S — CID 111179193
2-methyl-1-(2-methylpropyl)-3-(2-methylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111179193) has the molecular formula C9H22IN3S and a molecular weight of 331.27 g/mol. Its IUPAC name is 2-methyl-1-(2-methylpropyl)-3-(2-methylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methylpropyl)-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111179193 |
| Molecular Formula | C9H22IN3S |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 2-methyl-1-(2-methylpropyl)-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCSC)NCC(C)C.I |
| InChI | InChI=1S/C9H21N3S.HI/c1-8(2)7-12-9(10-3)11-5-6-13-4;/h8H,5-7H2,1-4H3,(H2,10,11,12);1H |
| InChIKey | IIPKVBPXVRWLFA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|