C11H25N3S — CID 111778685
1-(2-ethylbutyl)-2-methyl-3-(2-methylsulfanylethyl)guanidine (PubChem CID 111778685) has the molecular formula C11H25N3S and a molecular weight of 231.41 g/mol. Its IUPAC name is 1-(2-ethylbutyl)-2-methyl-3-(2-methylsulfanylethyl)guanidine.
| Compound Name | 1-(2-ethylbutyl)-2-methyl-3-(2-methylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111778685 |
| Molecular Formula | C11H25N3S |
| Molecular Weight | 231.41 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 1-(2-ethylbutyl)-2-methyl-3-(2-methylsulfanylethyl)guanidine |
| SMILES | CCC(CC)CN/C(=N/C)NCCSC |
| InChI | InChI=1S/C11H25N3S/c1-5-10(6-2)9-14-11(12-3)13-7-8-15-4/h10H,5-9H2,1-4H3,(H2,12,13,14) |
| InChIKey | IPQSUJZSRNCJJV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|