C12H27N3O — CID 111891019
1-(2-ethoxyethyl)-3-(2-ethylbutyl)-2-methylguanidine (PubChem CID 111891019) has the molecular formula C12H27N3O and a molecular weight of 229.37 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-3-(2-ethylbutyl)-2-methylguanidine.
| Compound Name | 1-(2-ethoxyethyl)-3-(2-ethylbutyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111891019 |
| Molecular Formula | C12H27N3O |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | 1-(2-ethoxyethyl)-3-(2-ethylbutyl)-2-methylguanidine |
| SMILES | CCOCCN/C(=N\C)NCC(CC)CC |
| InChI | InChI=1S/C12H27N3O/c1-5-11(6-2)10-15-12(13-4)14-8-9-16-7-3/h11H,5-10H2,1-4H3,(H2,13,14,15) |
| InChIKey | NDSLWOWYRBEHRI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|