C10H24IN3O — CID 110946213
1-butan-2-yl-3-(2-ethoxyethyl)-2-methylguanidine;hydroiodide (PubChem CID 110946213) has the molecular formula C10H24IN3O and a molecular weight of 329.23 g/mol. Its IUPAC name is 1-butan-2-yl-3-(2-ethoxyethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-butan-2-yl-3-(2-ethoxyethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110946213 |
| Molecular Formula | C10H24IN3O |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 1-butan-2-yl-3-(2-ethoxyethyl)-2-methylguanidine;hydroiodide |
| SMILES | CCOCCN/C(=N\C)NC(C)CC.I |
| InChI | InChI=1S/C10H23N3O.HI/c1-5-9(3)13-10(11-4)12-7-8-14-6-2;/h9H,5-8H2,1-4H3,(H2,11,12,13);1H |
| InChIKey | XCHUGGOKHFMKRU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|