C9H22IN3O2 — CID 111237010
1-(2-methoxyethyl)-3-(1-methoxypropan-2-yl)-2-methylguanidine;hydroiodide (PubChem CID 111237010) has the molecular formula C9H22IN3O2 and a molecular weight of 331.20 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-(1-methoxypropan-2-yl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-(2-methoxyethyl)-3-(1-methoxypropan-2-yl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111237010 |
| Molecular Formula | C9H22IN3O2 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 1-(2-methoxyethyl)-3-(1-methoxypropan-2-yl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCOC)NC(C)COC.I |
| InChI | InChI=1S/C9H21N3O2.HI/c1-8(7-14-4)12-9(10-2)11-5-6-13-3;/h8H,5-7H2,1-4H3,(H2,10,11,12);1H |
| InChIKey | LWQLMDPSMKAAJL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|