C12H25IN6O — CID 111513067
1-(1-methoxypropan-2-yl)-2-methyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide (PubChem CID 111513067) has the molecular formula C12H25IN6O and a molecular weight of 396.28 g/mol. Its IUPAC name is 1-(1-methoxypropan-2-yl)-2-methyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide.
| Compound Name | 1-(1-methoxypropan-2-yl)-2-methyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111513067 |
| Molecular Formula | C12H25IN6O |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 1-(1-methoxypropan-2-yl)-2-methyl-3-[4-(1,2,4-triazol-4-yl)butyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCCn1cnnc1)NC(C)COC.I |
| InChI | InChI=1S/C12H24N6O.HI/c1-11(8-19-3)17-12(13-2)14-6-4-5-7-18-9-15-16-10-18;/h9-11H,4-8H2,1-3H3,(H2,13,14,17);1H |
| InChIKey | YAQHYSYJOQRJRI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|