C11H20F3IN6 — CID 111985350
2-methyl-1-[4-(1,2,4-triazol-4-yl)butyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 111985350) has the molecular formula C11H20F3IN6 and a molecular weight of 420.22 g/mol. Its IUPAC name is 2-methyl-1-[4-(1,2,4-triazol-4-yl)butyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[4-(1,2,4-triazol-4-yl)butyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111985350 |
| Molecular Formula | C11H20F3IN6 |
| Molecular Weight | 420.22 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 2-methyl-1-[4-(1,2,4-triazol-4-yl)butyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCCn1cnnc1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C11H19F3N6.HI/c1-15-10(17-6-4-11(12,13)14)16-5-2-3-7-20-8-18-19-9-20;/h8-9H,2-7H2,1H3,(H2,15,16,17);1H |
| InChIKey | XWVUZRGVTFHOHN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|