C12H21F3N6 — CID 111985353
1-ethyl-2-[4-(1,2,4-triazol-4-yl)butyl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 111985353) has the molecular formula C12H21F3N6 and a molecular weight of 306.34 g/mol. Its IUPAC name is 1-ethyl-2-[4-(1,2,4-triazol-4-yl)butyl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-ethyl-2-[4-(1,2,4-triazol-4-yl)butyl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 111985353 |
| Molecular Formula | C12H21F3N6 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 1-ethyl-2-[4-(1,2,4-triazol-4-yl)butyl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCN/C(=N\CCCCn1cnnc1)NCCC(F)(F)F |
| InChI | InChI=1S/C12H21F3N6/c1-2-16-11(18-7-5-12(13,14)15)17-6-3-4-8-21-9-19-20-10-21/h9-10H,2-8H2,1H3,(H2,16,17,18) |
| InChIKey | BVQGQRNJEHIHKT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|