C24H32N6 — CID 111513002
1-(3,3-diphenylpropyl)-3-ethyl-2-[4-(1,2,4-triazol-4-yl)butyl]guanidine (PubChem CID 111513002) has the molecular formula C24H32N6 and a molecular weight of 404.56 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-3-ethyl-2-[4-(1,2,4-triazol-4-yl)butyl]guanidine.
| Compound Name | 1-(3,3-diphenylpropyl)-3-ethyl-2-[4-(1,2,4-triazol-4-yl)butyl]guanidine |
|---|---|
| PubChem CID | 111513002 |
| Molecular Formula | C24H32N6 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-3-ethyl-2-[4-(1,2,4-triazol-4-yl)butyl]guanidine |
| SMILES | CCN/C(=N\CCCCn1cnnc1)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32N6/c1-2-25-24(26-16-9-10-18-30-19-28-29-20-30)27-17-15-23(21-11-5-3-6-12-21)22-13-7-4-8-14-22/h3-8,11-14,19-20,23H,2,9-10,15-18H2,1H3,(H2,25,26,27) |
| InChIKey | OMMWFBLMPSWGKR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|