C22H32N4O2S — CID 111233665
1-(3,3-diphenylpropyl)-3-ethyl-2-[3-(methanesulfonamido)propyl]guanidine (PubChem CID 111233665) has the molecular formula C22H32N4O2S and a molecular weight of 416.59 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-3-ethyl-2-[3-(methanesulfonamido)propyl]guanidine.
| Compound Name | 1-(3,3-diphenylpropyl)-3-ethyl-2-[3-(methanesulfonamido)propyl]guanidine |
|---|---|
| PubChem CID | 111233665 |
| Molecular Formula | C22H32N4O2S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-3-ethyl-2-[3-(methanesulfonamido)propyl]guanidine |
| SMILES | CCN/C(=N\CCCNS(C)(=O)=O)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H32N4O2S/c1-3-23-22(24-16-10-17-26-29(2,27)28)25-18-15-21(19-11-6-4-7-12-19)20-13-8-5-9-14-20/h4-9,11-14,21,26H,3,10,15-18H2,1-2H3,(H2,23,24,25) |
| InChIKey | AOCURRFWRBVKKI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|