C20H28N4O2S — CID 111233859
2-(3,3-diphenylpropyl)-1-ethyl-3-(2-sulfamoylethyl)guanidine (PubChem CID 111233859) has the molecular formula C20H28N4O2S and a molecular weight of 388.54 g/mol. Its IUPAC name is 2-(3,3-diphenylpropyl)-1-ethyl-3-(2-sulfamoylethyl)guanidine.
| Compound Name | 2-(3,3-diphenylpropyl)-1-ethyl-3-(2-sulfamoylethyl)guanidine |
|---|---|
| PubChem CID | 111233859 |
| Molecular Formula | C20H28N4O2S |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-(3,3-diphenylpropyl)-1-ethyl-3-(2-sulfamoylethyl)guanidine |
| SMILES | CCN/C(=N\CCC(c1ccccc1)c1ccccc1)NCCS(N)(=O)=O |
| InChI | InChI=1S/C20H28N4O2S/c1-2-22-20(24-15-16-27(21,25)26)23-14-13-19(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,19H,2,13-16H2,1H3,(H2,21,25,26)(H2,22,23,24) |
| InChIKey | TXDUDYFTLWAQGW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|