C17H32IN5O2S — CID 111011334
2-[2-(diethylamino)-2-phenylethyl]-1-ethyl-3-(2-sulfamoylethyl)guanidine;hydroiodide (PubChem CID 111011334) has the molecular formula C17H32IN5O2S and a molecular weight of 497.45 g/mol. Its IUPAC name is 2-[2-(diethylamino)-2-phenylethyl]-1-ethyl-3-(2-sulfamoylethyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(diethylamino)-2-phenylethyl]-1-ethyl-3-(2-sulfamoylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111011334 |
| Molecular Formula | C17H32IN5O2S |
| Molecular Weight | 497.45 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 2-[2-(diethylamino)-2-phenylethyl]-1-ethyl-3-(2-sulfamoylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccccc1)N(CC)CC)NCCS(N)(=O)=O.I |
| InChI | InChI=1S/C17H31N5O2S.HI/c1-4-19-17(20-12-13-25(18,23)24)21-14-16(22(5-2)6-3)15-10-8-7-9-11-15;/h7-11,16H,4-6,12-14H2,1-3H3,(H2,18,23,24)(H2,19,20,21);1H |
| InChIKey | UPQZKPFUQIHKGI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.45 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|