C22H35IN6OS — CID 111011162
N-[2-[[N'-[2-(diethylamino)-2-phenylethyl]-N-ethylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide (PubChem CID 111011162) has the molecular formula C22H35IN6OS and a molecular weight of 558.53 g/mol. Its IUPAC name is N-[2-[[N'-[2-(diethylamino)-2-phenylethyl]-N-ethylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N'-[2-(diethylamino)-2-phenylethyl]-N-ethylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111011162 |
| Molecular Formula | C22H35IN6OS |
| Molecular Weight | 558.53 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | N-[2-[[N'-[2-(diethylamino)-2-phenylethyl]-N-ethylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccccc1)N(CC)CC)NCCNC(=O)c1scnc1C.I |
| InChI | InChI=1S/C22H34N6OS.HI/c1-5-23-22(25-14-13-24-21(29)20-17(4)27-16-30-20)26-15-19(28(6-2)7-3)18-11-9-8-10-12-18;/h8-12,16,19H,5-7,13-15H2,1-4H3,(H,24,29)(H2,23,25,26);1H |
| InChIKey | ZBRJGUHMEIFBPD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|