C23H28IN5OS — CID 111356877
N-[2-[[N-(2,2-diphenylethyl)-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide (PubChem CID 111356877) has the molecular formula C23H28IN5OS and a molecular weight of 549.48 g/mol. Its IUPAC name is N-[2-[[N-(2,2-diphenylethyl)-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N-(2,2-diphenylethyl)-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111356877 |
| Molecular Formula | C23H28IN5OS |
| Molecular Weight | 549.48 g/mol |
| Exact Mass | 549.11 |
| IUPAC Name | N-[2-[[N-(2,2-diphenylethyl)-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)c1scnc1C)NCC(c1ccccc1)c1ccccc1.I |
| InChI | InChI=1S/C23H27N5OS.HI/c1-17-21(30-16-28-17)22(29)25-13-14-26-23(24-2)27-15-20(18-9-5-3-6-10-18)19-11-7-4-8-12-19;/h3-12,16,20H,13-15H2,1-2H3,(H,25,29)(H2,24,26,27);1H |
| InChIKey | CNGJRNQAJXZZER-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|