C20H27F3IN5OS — CID 111711810
4-methyl-N-[2-[[N'-methyl-N-[3-[3-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]ethyl]-1,3-thiazole-5-carboxamide;hydroiodide (PubChem CID 111711810) has the molecular formula C20H27F3IN5OS and a molecular weight of 569.44 g/mol. Its IUPAC name is 4-methyl-N-[2-[[N'-methyl-N-[3-[3-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]ethyl]-1,3-thiazole-5-carboxamide;hydroiodide.
| Compound Name | 4-methyl-N-[2-[[N'-methyl-N-[3-[3-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]ethyl]-1,3-thiazole-5-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111711810 |
| Molecular Formula | C20H27F3IN5OS |
| Molecular Weight | 569.44 g/mol |
| Exact Mass | 569.09 |
| IUPAC Name | 4-methyl-N-[2-[[N'-methyl-N-[3-[3-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]ethyl]-1,3-thiazole-5-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)c1scnc1C)NCCC(C)c1cccc(C(F)(F)F)c1.I |
| InChI | InChI=1S/C20H26F3N5OS.HI/c1-13(15-5-4-6-16(11-15)20(21,22)23)7-8-26-19(24-3)27-10-9-25-18(29)17-14(2)28-12-30-17;/h4-6,11-13H,7-10H2,1-3H3,(H,25,29)(H2,24,26,27);1H |
| InChIKey | FTDYHBDSAQNUOT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|