C17H33IN6OS — CID 111248150
N-[2-[[N-[2-[di(propan-2-yl)amino]ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide (PubChem CID 111248150) has the molecular formula C17H33IN6OS and a molecular weight of 496.46 g/mol. Its IUPAC name is N-[2-[[N-[2-[di(propan-2-yl)amino]ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N-[2-[di(propan-2-yl)amino]ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111248150 |
| Molecular Formula | C17H33IN6OS |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | N-[2-[[N-[2-[di(propan-2-yl)amino]ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCCNC(=O)c1scnc1C)NCCN(C(C)C)C(C)C.I |
| InChI | InChI=1S/C17H32N6OS.HI/c1-12(2)23(13(3)4)10-9-21-17(18-6)20-8-7-19-16(24)15-14(5)22-11-25-15;/h11-13H,7-10H2,1-6H3,(H,19,24)(H2,18,20,21);1H |
| InChIKey | GRHBIEYDKJXBFT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|