C16H31IN6O2S — CID 111653047
N-[2-[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide (PubChem CID 111653047) has the molecular formula C16H31IN6O2S and a molecular weight of 498.44 g/mol. Its IUPAC name is N-[2-[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111653047 |
| Molecular Formula | C16H31IN6O2S |
| Molecular Weight | 498.44 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | N-[2-[[N-[2-[3-methoxypropyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCCNC(=O)c1scnc1C)NCCN(C)CCCOC.I |
| InChI | InChI=1S/C16H30N6O2S.HI/c1-13-14(25-12-21-13)15(23)18-6-7-19-16(17-2)20-8-10-22(3)9-5-11-24-4;/h12H,5-11H2,1-4H3,(H,18,23)(H2,17,19,20);1H |
| InChIKey | WZGLXXKBWBXCMW-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.44 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|