C16H22IN5OS — CID 110954335
N-[2-[(N-benzyl-N'-methylcarbamimidoyl)amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide (PubChem CID 110954335) has the molecular formula C16H22IN5OS and a molecular weight of 459.36 g/mol. Its IUPAC name is N-[2-[(N-benzyl-N'-methylcarbamimidoyl)amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide.
| Compound Name | N-[2-[(N-benzyl-N'-methylcarbamimidoyl)amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 110954335 |
| Molecular Formula | C16H22IN5OS |
| Molecular Weight | 459.36 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | N-[2-[(N-benzyl-N'-methylcarbamimidoyl)amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)c1scnc1C)NCc1ccccc1.I |
| InChI | InChI=1S/C16H21N5OS.HI/c1-12-14(23-11-21-12)15(22)18-8-9-19-16(17-2)20-10-13-6-4-3-5-7-13;/h3-7,11H,8-10H2,1-2H3,(H,18,22)(H2,17,19,20);1H |
| InChIKey | USWWQXZQVJNHJA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|