C16H20ClN5OS — CID 111131084
N-[2-[[N-[(4-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 111131084) has the molecular formula C16H20ClN5OS and a molecular weight of 365.89 g/mol. Its IUPAC name is N-[2-[[N-[(4-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-[[N-[(4-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 111131084 |
| Molecular Formula | C16H20ClN5OS |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | N-[2-[[N-[(4-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | C/N=C(\NCCNC(=O)c1scnc1C)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClN5OS/c1-11-14(24-10-22-11)15(23)19-7-8-20-16(18-2)21-9-12-3-5-13(17)6-4-12/h3-6,10H,7-9H2,1-2H3,(H,19,23)(H2,18,20,21) |
| InChIKey | OPNBXSSTJQYGEO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|