C18H26IN5O2S — CID 111417572
4-methyl-N-[2-[[N'-methyl-N-(3-phenoxypropyl)carbamimidoyl]amino]ethyl]-1,3-thiazole-5-carboxamide;hydroiodide (PubChem CID 111417572) has the molecular formula C18H26IN5O2S and a molecular weight of 503.41 g/mol. Its IUPAC name is 4-methyl-N-[2-[[N'-methyl-N-(3-phenoxypropyl)carbamimidoyl]amino]ethyl]-1,3-thiazole-5-carboxamide;hydroiodide.
| Compound Name | 4-methyl-N-[2-[[N'-methyl-N-(3-phenoxypropyl)carbamimidoyl]amino]ethyl]-1,3-thiazole-5-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111417572 |
| Molecular Formula | C18H26IN5O2S |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | 4-methyl-N-[2-[[N'-methyl-N-(3-phenoxypropyl)carbamimidoyl]amino]ethyl]-1,3-thiazole-5-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCCCOc1ccccc1)NCCNC(=O)c1scnc1C.I |
| InChI | InChI=1S/C18H25N5O2S.HI/c1-14-16(26-13-23-14)17(24)20-10-11-22-18(19-2)21-9-6-12-25-15-7-4-3-5-8-15;/h3-5,7-8,13H,6,9-12H2,1-2H3,(H,20,24)(H2,19,21,22);1H |
| InChIKey | OENMYWBGQAFSSM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|