C21H31N5OS — CID 111694512
N-[2-[[N-(2-ethyl-2-phenylbutyl)-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 111694512) has the molecular formula C21H31N5OS and a molecular weight of 401.58 g/mol. Its IUPAC name is N-[2-[[N-(2-ethyl-2-phenylbutyl)-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-[[N-(2-ethyl-2-phenylbutyl)-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 111694512 |
| Molecular Formula | C21H31N5OS |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | N-[2-[[N-(2-ethyl-2-phenylbutyl)-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCC(CC)(CN/C(=N/C)NCCNC(=O)c1scnc1C)c1ccccc1 |
| InChI | InChI=1S/C21H31N5OS/c1-5-21(6-2,17-10-8-7-9-11-17)14-25-20(22-4)24-13-12-23-19(27)18-16(3)26-15-28-18/h7-11,15H,5-6,12-14H2,1-4H3,(H,23,27)(H2,22,24,25) |
| InChIKey | TUMDTOSWPMZUIR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|