C20H25ClN4O2 — CID 111417417
2-chloro-N-[2-[[N'-methyl-N-(3-phenoxypropyl)carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111417417) has the molecular formula C20H25ClN4O2 and a molecular weight of 388.90 g/mol. Its IUPAC name is 2-chloro-N-[2-[[N'-methyl-N-(3-phenoxypropyl)carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[N'-methyl-N-(3-phenoxypropyl)carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111417417 |
| Molecular Formula | C20H25ClN4O2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2-chloro-N-[2-[[N'-methyl-N-(3-phenoxypropyl)carbamimidoyl]amino]ethyl]benzamide |
| SMILES | C/N=C(\NCCCOc1ccccc1)NCCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C20H25ClN4O2/c1-22-20(24-12-7-15-27-16-8-3-2-4-9-16)25-14-13-23-19(26)17-10-5-6-11-18(17)21/h2-6,8-11H,7,12-15H2,1H3,(H,23,26)(H2,22,24,25) |
| InChIKey | ZDYSTNNELRGXQJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|