C19H24ClIN4O2 — CID 111005736
2-chloro-N-[2-[[N'-methyl-N-(2-phenoxyethyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 111005736) has the molecular formula C19H24ClIN4O2 and a molecular weight of 502.78 g/mol. Its IUPAC name is 2-chloro-N-[2-[[N'-methyl-N-(2-phenoxyethyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | 2-chloro-N-[2-[[N'-methyl-N-(2-phenoxyethyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111005736 |
| Molecular Formula | C19H24ClIN4O2 |
| Molecular Weight | 502.78 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | 2-chloro-N-[2-[[N'-methyl-N-(2-phenoxyethyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | C/N=C(/NCCNC(=O)c1ccccc1Cl)NCCOc1ccccc1.I |
| InChI | InChI=1S/C19H23ClN4O2.HI/c1-21-19(24-13-14-26-15-7-3-2-4-8-15)23-12-11-22-18(25)16-9-5-6-10-17(16)20;/h2-10H,11-14H2,1H3,(H,22,25)(H2,21,23,24);1H |
| InChIKey | JQMVYZSTVFRZMX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.78 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|