C20H31IN6OS — CID 111330767
N-[2-[[N-[2-(N-ethyl-3-methylanilino)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide (PubChem CID 111330767) has the molecular formula C20H31IN6OS and a molecular weight of 530.48 g/mol. Its IUPAC name is N-[2-[[N-[2-(N-ethyl-3-methylanilino)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N-[2-(N-ethyl-3-methylanilino)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111330767 |
| Molecular Formula | C20H31IN6OS |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | N-[2-[[N-[2-(N-ethyl-3-methylanilino)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
| SMILES | CCN(CCN/C(=N/C)NCCNC(=O)c1scnc1C)c1cccc(C)c1.I |
| InChI | InChI=1S/C20H30N6OS.HI/c1-5-26(17-8-6-7-15(2)13-17)12-11-24-20(21-4)23-10-9-22-19(27)18-16(3)25-14-28-18;/h6-8,13-14H,5,9-12H2,1-4H3,(H,22,27)(H2,21,23,24);1H |
| InChIKey | QKHZWZQGJRFJFC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|