C19H31IN6S — CID 111964900
1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-[2-(N-ethyl-3-methylanilino)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111964900) has the molecular formula C19H31IN6S and a molecular weight of 502.47 g/mol. Its IUPAC name is 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-[2-(N-ethyl-3-methylanilino)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-[2-(N-ethyl-3-methylanilino)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111964900 |
| Molecular Formula | C19H31IN6S |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-[2-(N-ethyl-3-methylanilino)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCN(CCN/C(=N/C)NCc1csc(N(C)C)n1)c1cccc(C)c1.I |
| InChI | InChI=1S/C19H30N6S.HI/c1-6-25(17-9-7-8-15(2)12-17)11-10-21-18(20-3)22-13-16-14-26-19(23-16)24(4)5;/h7-9,12,14H,6,10-11,13H2,1-5H3,(H2,20,21,22);1H |
| InChIKey | RHFCZLXCALQUSE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|