C21H29N5OS — CID 111855252
N-[2-[[N-ethyl-N'-[(1-phenylcyclobutyl)methyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 111855252) has the molecular formula C21H29N5OS and a molecular weight of 399.56 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[(1-phenylcyclobutyl)methyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-[[N-ethyl-N'-[(1-phenylcyclobutyl)methyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 111855252 |
| Molecular Formula | C21H29N5OS |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[(1-phenylcyclobutyl)methyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCN/C(=N\CC1(c2ccccc2)CCC1)NCCNC(=O)c1scnc1C |
| InChI | InChI=1S/C21H29N5OS/c1-3-22-20(24-13-12-23-19(27)18-16(2)26-15-28-18)25-14-21(10-7-11-21)17-8-5-4-6-9-17/h4-6,8-9,15H,3,7,10-14H2,1-2H3,(H,23,27)(H2,22,24,25) |
| InChIKey | LZYKGPNYJCFYPF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|