C14H25N5OS — CID 111150535
N-[2-[(N'-butyl-N-ethylcarbamimidoyl)amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 111150535) has the molecular formula C14H25N5OS and a molecular weight of 311.46 g/mol. Its IUPAC name is N-[2-[(N'-butyl-N-ethylcarbamimidoyl)amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-[(N'-butyl-N-ethylcarbamimidoyl)amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 111150535 |
| Molecular Formula | C14H25N5OS |
| Molecular Weight | 311.46 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | N-[2-[(N'-butyl-N-ethylcarbamimidoyl)amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCCC/N=C(\NCC)NCCNC(=O)c1scnc1C |
| InChI | InChI=1S/C14H25N5OS/c1-4-6-7-17-14(15-5-2)18-9-8-16-13(20)12-11(3)19-10-21-12/h10H,4-9H2,1-3H3,(H,16,20)(H2,15,17,18) |
| InChIKey | VYHSYALDXRRMJD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.46 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|