C16H24IN5O2S — CID 111356761
N-[2-[[N-ethyl-N'-[2-(furan-2-yl)ethyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide (PubChem CID 111356761) has the molecular formula C16H24IN5O2S and a molecular weight of 477.37 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[2-(furan-2-yl)ethyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[2-(furan-2-yl)ethyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111356761 |
| Molecular Formula | C16H24IN5O2S |
| Molecular Weight | 477.37 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[2-(furan-2-yl)ethyl]carbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccco1)NCCNC(=O)c1scnc1C.I |
| InChI | InChI=1S/C16H23N5O2S.HI/c1-3-17-16(19-7-6-13-5-4-10-23-13)20-9-8-18-15(22)14-12(2)21-11-24-14;/h4-5,10-11H,3,6-9H2,1-2H3,(H,18,22)(H2,17,19,20);1H |
| InChIKey | FZTXUXCIUYFUGF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|